C23H23ClN6O3 — CID 171133723
7-[(4-chlorophenyl)methyl]-8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 171133723) has the molecular formula C23H23ClN6O3 and a molecular weight of 466.93 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 171133723 |
| Molecular Formula | C23H23ClN6O3 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCOc1ccc(C=NNc2nc3c(c(=O)n(C)c(=O)n3C)n2Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H23ClN6O3/c1-4-33-18-11-7-15(8-12-18)13-25-27-22-26-20-19(21(31)29(3)23(32)28(20)2)30(22)14-16-5-9-17(24)10-6-16/h5-13H,4,14H2,1-3H3,(H,26,27) |
| InChIKey | LOTVOSMVJDSEBJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|