C26H30N6O6 — CID 4195564
8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 4195564) has the molecular formula C26H30N6O6 and a molecular weight of 522.56 g/mol. Its IUPAC name is 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4195564 |
| Molecular Formula | C26H30N6O6 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCOc1ccc(C=NNc2nc3c(c(=O)n(C)c(=O)n3C)n2CC(O)COc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H30N6O6/c1-5-37-20-8-6-17(7-9-20)14-27-29-25-28-23-22(24(34)31(3)26(35)30(23)2)32(25)15-18(33)16-38-21-12-10-19(36-4)11-13-21/h6-14,18,33H,5,15-16H2,1-4H3,(H,28,29) |
| InChIKey | QBTDVFAJCRTGGW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 134.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|