C26H30N6O5 — CID 3832510
8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 3832510) has the molecular formula C26H30N6O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3832510 |
| Molecular Formula | C26H30N6O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(3-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCOc1ccc(C=NNc2nc3c(c(=O)n(C)c(=O)n3C)n2CC(O)COc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C26H30N6O5/c1-5-36-20-11-9-18(10-12-20)14-27-29-25-28-23-22(24(34)31(4)26(35)30(23)3)32(25)15-19(33)16-37-21-8-6-7-17(2)13-21/h6-14,19,33H,5,15-16H2,1-4H3,(H,28,29) |
| InChIKey | XSAVYFPALIXZFF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|