C22H23N7O7 — CID 18593343
7-[2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-dimethyl-8-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purine-2,6-dione (PubChem CID 18593343) has the molecular formula C22H23N7O7 and a molecular weight of 497.47 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-dimethyl-8-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-dimethyl-8-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 18593343 |
| Molecular Formula | C22H23N7O7 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 7-[2-hydroxy-3-(4-methylphenoxy)propyl]-1,3-dimethyl-8-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]purine-2,6-dione |
| SMILES | Cc1ccc(OCC(O)Cn2c(N/N=C/c3ccc([N+](=O)[O-])o3)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H23N7O7/c1-13-4-6-15(7-5-13)35-12-14(30)11-28-18-19(26(2)22(32)27(3)20(18)31)24-21(28)25-23-10-16-8-9-17(36-16)29(33)34/h4-10,14,30H,11-12H2,1-3H3,(H,24,25)/b23-10+ |
| InChIKey | PQBBPSUHHQLNIC-AUEPDCJTSA-N |
| XLogP | 1.13 |
| TPSA | 171.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|