C24H25N7O6 — CID 40830865
7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethyl-8-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione (PubChem CID 40830865) has the molecular formula C24H25N7O6 and a molecular weight of 507.51 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethyl-8-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethyl-8-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 40830865 |
| Molecular Formula | C24H25N7O6 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethyl-8-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
| SMILES | Cc1ccccc1OC[C@@H](O)Cn1c(N/N=C\c2cccc([N+](=O)[O-])c2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C24H25N7O6/c1-15-7-4-5-10-19(15)37-14-18(32)13-30-20-21(28(2)24(34)29(3)22(20)33)26-23(30)27-25-12-16-8-6-9-17(11-16)31(35)36/h4-12,18,32H,13-14H2,1-3H3,(H,26,27)/b25-12-/t18-/m0/s1 |
| InChIKey | QMUCALNYABMXIW-OCBWPWIBSA-N |
| XLogP | 1.54 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|