C17H18ClN7O2 — CID 3738631
7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione (PubChem CID 3738631) has the molecular formula C17H18ClN7O2 and a molecular weight of 387.83 g/mol. Its IUPAC name is 7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 3738631 |
| Molecular Formula | C17H18ClN7O2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 7-(3-chlorobut-2-enyl)-1,3-dimethyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
| SMILES | CC(Cl)=CCn1c(NN=Cc2cccnc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H18ClN7O2/c1-11(18)6-8-25-13-14(23(2)17(27)24(3)15(13)26)21-16(25)22-20-10-12-5-4-7-19-9-12/h4-7,9-10H,8H2,1-3H3,(H,21,22) |
| InChIKey | NEVHEHCEXDPUEQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|