C11H15ClN6O2 — CID 6341383
7-[(E)-3-chlorobut-2-enyl]-8-hydrazinyl-1,3-dimethylpurine-2,6-dione (PubChem CID 6341383) has the molecular formula C11H15ClN6O2 and a molecular weight of 298.73 g/mol. Its IUPAC name is 7-[(E)-3-chlorobut-2-enyl]-8-hydrazinyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(E)-3-chlorobut-2-enyl]-8-hydrazinyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 6341383 |
| Molecular Formula | C11H15ClN6O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 7-[(E)-3-chlorobut-2-enyl]-8-hydrazinyl-1,3-dimethylpurine-2,6-dione |
| SMILES | C/C(Cl)=C\Cn1c(NN)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H15ClN6O2/c1-6(12)4-5-18-7-8(14-10(18)15-13)16(2)11(20)17(3)9(7)19/h4H,5,13H2,1-3H3,(H,14,15)/b6-4+ |
| InChIKey | GNXWODCLEXUBMR-GQCTYLIASA-N |
| XLogP | -0.14 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|