C14H16N6O2 — CID 839657
7-benzyl-8-hydrazinyl-1,3-dimethylpurine-2,6-dione (PubChem CID 839657) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 7-benzyl-8-hydrazinyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-benzyl-8-hydrazinyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 839657 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 7-benzyl-8-hydrazinyl-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NN)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C14H16N6O2/c1-18-11-10(12(21)19(2)14(18)22)20(13(16-11)17-15)8-9-6-4-3-5-7-9/h3-7H,8,15H2,1-2H3,(H,16,17) |
| InChIKey | OIKMOIADJPVFJH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|