C23H25N7O3 — CID 178183266
N-[2-[2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)hydrazinyl]ethyl]benzamide (PubChem CID 178183266) has the molecular formula C23H25N7O3 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[2-[2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)hydrazinyl]ethyl]benzamide.
| Compound Name | N-[2-[2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 178183266 |
| Molecular Formula | C23H25N7O3 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[2-[2-(7-benzyl-1,3-dimethyl-2,6-dioxopurin-8-yl)hydrazinyl]ethyl]benzamide |
| SMILES | Cn1c(=O)c2c(nc(NNCCNC(=O)c3ccccc3)n2Cc2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C23H25N7O3/c1-28-19-18(21(32)29(2)23(28)33)30(15-16-9-5-3-6-10-16)22(26-19)27-25-14-13-24-20(31)17-11-7-4-8-12-17/h3-12,25H,13-15H2,1-2H3,(H,24,31)(H,26,27) |
| InChIKey | WPRAPSRQBNFIOZ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|