C16H16BrN5O3 — CID 15643349
N-[2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]benzamide (PubChem CID 15643349) has the molecular formula C16H16BrN5O3 and a molecular weight of 406.24 g/mol. Its IUPAC name is N-[2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]benzamide.
| Compound Name | N-[2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 15643349 |
| Molecular Formula | C16H16BrN5O3 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | N-[2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl]benzamide |
| SMILES | Cn1c(=O)c2c(nc(Br)n2CCNC(=O)c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C16H16BrN5O3/c1-20-12-11(14(24)21(2)16(20)25)22(15(17)19-12)9-8-18-13(23)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,18,23) |
| InChIKey | FARVJZNHGTWMNX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |