C16H25BrN4O2 — CID 82018549
8-bromo-1,3-dimethyl-7-nonylpurine-2,6-dione (PubChem CID 82018549) has the molecular formula C16H25BrN4O2 and a molecular weight of 385.31 g/mol. Its IUPAC name is 8-bromo-1,3-dimethyl-7-nonylpurine-2,6-dione.
| Compound Name | 8-bromo-1,3-dimethyl-7-nonylpurine-2,6-dione |
|---|---|
| PubChem CID | 82018549 |
| Molecular Formula | C16H25BrN4O2 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 8-bromo-1,3-dimethyl-7-nonylpurine-2,6-dione |
| SMILES | CCCCCCCCCn1c(Br)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H25BrN4O2/c1-4-5-6-7-8-9-10-11-21-12-13(18-15(21)17)19(2)16(23)20(3)14(12)22/h4-11H2,1-3H3 |
| InChIKey | JRTAUJPFIXIUMC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|