C15H24N4O2S — CID 2967939
7-heptyl-1,3-dimethyl-8-methylsulfanylpurine-2,6-dione (PubChem CID 2967939) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 7-heptyl-1,3-dimethyl-8-methylsulfanylpurine-2,6-dione.
| Compound Name | 7-heptyl-1,3-dimethyl-8-methylsulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 2967939 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 7-heptyl-1,3-dimethyl-8-methylsulfanylpurine-2,6-dione |
| SMILES | CCCCCCCn1c(SC)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H24N4O2S/c1-5-6-7-8-9-10-19-11-12(16-14(19)22-4)17(2)15(21)18(3)13(11)20/h5-10H2,1-4H3 |
| InChIKey | ZAJDDOAARGGIMC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|