C19H29N4O4S- — CID 3506716
2-(7-decyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate (PubChem CID 3506716) has the molecular formula C19H29N4O4S- and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(7-decyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate.
| Compound Name | 2-(7-decyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3506716 |
| Molecular Formula | C19H29N4O4S- |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-(7-decyl-1,3-dimethyl-2,6-dioxopurin-8-yl)sulfanylacetate |
| SMILES | CCCCCCCCCCn1c(SCC(=O)[O-])nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C19H30N4O4S/c1-4-5-6-7-8-9-10-11-12-23-15-16(20-18(23)28-13-14(24)25)21(2)19(27)22(3)17(15)26/h4-13H2,1-3H3,(H,24,25)/p-1 |
| InChIKey | VTMGWIGRYYAKHT-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 101.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|