C14H21BrN4O2 — CID 3137699
8-bromo-7-heptyl-1,3-dimethylpurine-2,6-dione (PubChem CID 3137699) has the molecular formula C14H21BrN4O2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 8-bromo-7-heptyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-bromo-7-heptyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3137699 |
| Molecular Formula | C14H21BrN4O2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 8-bromo-7-heptyl-1,3-dimethylpurine-2,6-dione |
| SMILES | CCCCCCCn1c(Br)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H21BrN4O2/c1-4-5-6-7-8-9-19-10-11(16-13(19)15)17(2)14(21)18(3)12(10)20/h4-9H2,1-3H3 |
| InChIKey | DJLWERPXJYURCC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|