C11H14Br2N4O2 — CID 7021213
8-bromo-7-[(2R)-2-bromobutyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 7021213) has the molecular formula C11H14Br2N4O2 and a molecular weight of 394.07 g/mol. Its IUPAC name is 8-bromo-7-[(2R)-2-bromobutyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-bromo-7-[(2R)-2-bromobutyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 7021213 |
| Molecular Formula | C11H14Br2N4O2 |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 8-bromo-7-[(2R)-2-bromobutyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC[C@@H](Br)Cn1c(Br)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C11H14Br2N4O2/c1-4-6(12)5-17-7-8(14-10(17)13)15(2)11(19)16(3)9(7)18/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | GOXWJGGJEIMMAB-ZCFIWIBFSA-N |
| XLogP | 1.37 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|