C10H12BrN7O2S — CID 5163300
[2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethylideneamino]thiourea (PubChem CID 5163300) has the molecular formula C10H12BrN7O2S and a molecular weight of 374.22 g/mol. Its IUPAC name is [2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethylideneamino]thiourea.
| Compound Name | [2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 5163300 |
| Molecular Formula | C10H12BrN7O2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | [2-(8-bromo-1,3-dimethyl-2,6-dioxopurin-7-yl)ethylideneamino]thiourea |
| SMILES | Cn1c(=O)c2c(nc(Br)n2CC=NNC(N)=S)n(C)c1=O |
| InChI | InChI=1S/C10H12BrN7O2S/c1-16-6-5(7(19)17(2)10(16)20)18(8(11)14-6)4-3-13-15-9(12)21/h3H,4H2,1-2H3,(H3,12,15,21) |
| InChIKey | INTXUNSOAPQUHB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|