C14H12BrN7O3 — CID 6297758
N-[(Z)-2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethylideneamino]pyridine-4-carboxamide (PubChem CID 6297758) has the molecular formula C14H12BrN7O3 and a molecular weight of 406.20 g/mol. Its IUPAC name is N-[(Z)-2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6297758 |
| Molecular Formula | C14H12BrN7O3 |
| Molecular Weight | 406.20 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | N-[(Z)-2-(8-bromo-3-methyl-2,6-dioxopurin-7-yl)ethylideneamino]pyridine-4-carboxamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Br)n2C/C=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C14H12BrN7O3/c1-21-10-9(12(24)19-14(21)25)22(13(15)18-10)7-6-17-20-11(23)8-2-4-16-5-3-8/h2-6H,7H2,1H3,(H,20,23)(H,19,24,25)/b17-6- |
| InChIKey | QHGHMVUVCRHIGA-FMQZQXMHSA-N |
| XLogP | -0.00 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.20 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|