C9H11N3O — CID 6119038
N-[(Z)-propylideneamino]pyridine-4-carboxamide (PubChem CID 6119038) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is N-[(Z)-propylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-propylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6119038 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N-[(Z)-propylideneamino]pyridine-4-carboxamide |
| SMILES | CC/C=N\NC(=O)c1ccncc1 |
| InChI | InChI=1S/C9H11N3O/c1-2-5-11-12-9(13)8-3-6-10-7-4-8/h3-7H,2H2,1H3,(H,12,13)/b11-5- |
| InChIKey | SNCFHIZNEFTJRP-WZUFQYTHSA-N |
| XLogP | 1.21 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|