C9H12N4O — CID 58684890
N-[(E)-3-aminopropylideneamino]pyridine-4-carboxamide (PubChem CID 58684890) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-[(E)-3-aminopropylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-3-aminopropylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58684890 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-[(E)-3-aminopropylideneamino]pyridine-4-carboxamide |
| SMILES | NCC/C=N/NC(=O)c1ccncc1 |
| InChI | InChI=1S/C9H12N4O/c10-4-1-5-12-13-9(14)8-2-6-11-7-3-8/h2-3,5-7H,1,4,10H2,(H,13,14)/b12-5+ |
| InChIKey | NJJMNNPGULZMKI-LFYBBSHMSA-N |
| XLogP | 0.15 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|