C11H18N4O — CID 142936010
N-[(E)-3-aminopropylideneamino]pyridine-2-carboxamide;ethane (PubChem CID 142936010) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[(E)-3-aminopropylideneamino]pyridine-2-carboxamide;ethane.
| Compound Name | N-[(E)-3-aminopropylideneamino]pyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142936010 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-[(E)-3-aminopropylideneamino]pyridine-2-carboxamide;ethane |
| SMILES | CC.NCC/C=N/NC(=O)c1ccccn1 |
| InChI | InChI=1S/C9H12N4O.C2H6/c10-5-3-7-12-13-9(14)8-4-1-2-6-11-8;1-2/h1-2,4,6-7H,3,5,10H2,(H,13,14);1-2H3/b12-7+; |
| InChIKey | MKSGBRUTRFLADD-RRAJOLSVSA-N |
| XLogP | 1.17 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|