C13H10BrN5O4 — CID 1108706
8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]purine-2,6-dione (PubChem CID 1108706) has the molecular formula C13H10BrN5O4 and a molecular weight of 380.16 g/mol. Its IUPAC name is 8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]purine-2,6-dione.
| Compound Name | 8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 1108706 |
| Molecular Formula | C13H10BrN5O4 |
| Molecular Weight | 380.16 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | 8-bromo-3-methyl-7-[(4-nitrophenyl)methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(Br)n2Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H10BrN5O4/c1-17-10-9(11(20)16-13(17)21)18(12(14)15-10)6-7-2-4-8(5-3-7)19(22)23/h2-5H,6H2,1H3,(H,16,20,21) |
| InChIKey | JTGMNXZGFYQMLD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|