C22H21N7O4 — CID 1420962
3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione (PubChem CID 1420962) has the molecular formula C22H21N7O4 and a molecular weight of 447.46 g/mol. Its IUPAC name is 3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 1420962 |
| Molecular Formula | C22H21N7O4 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 3-methyl-7-[(4-methylphenyl)methyl]-8-[2-[1-(4-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione |
| SMILES | CC(=NNc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1ccc(C)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H21N7O4/c1-13-4-6-15(7-5-13)12-28-18-19(27(3)22(31)24-20(18)30)23-21(28)26-25-14(2)16-8-10-17(11-9-16)29(32)33/h4-11H,12H2,1-3H3,(H,23,26)(H,24,30,31) |
| InChIKey | ZISXCEIZKFHJGL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|