C21H18BrN7O4 — CID 6173814
7-[(3-bromophenyl)methyl]-3-methyl-8-[(2Z)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione (PubChem CID 6173814) has the molecular formula C21H18BrN7O4 and a molecular weight of 512.32 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methyl]-3-methyl-8-[(2Z)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(3-bromophenyl)methyl]-3-methyl-8-[(2Z)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 6173814 |
| Molecular Formula | C21H18BrN7O4 |
| Molecular Weight | 512.32 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 7-[(3-bromophenyl)methyl]-3-methyl-8-[(2Z)-2-[1-(3-nitrophenyl)ethylidene]hydrazinyl]purine-2,6-dione |
| SMILES | C/C(=N/Nc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1cccc(Br)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18BrN7O4/c1-12(14-6-4-8-16(10-14)29(32)33)25-26-20-23-18-17(19(30)24-21(31)27(18)2)28(20)11-13-5-3-7-15(22)9-13/h3-10H,11H2,1-2H3,(H,23,26)(H,24,30,31)/b25-12- |
| InChIKey | OFYIPMPVIBQYET-ROTLSHHCSA-N |
| XLogP | 2.98 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|