C21H19FN6O3 — CID 3500292
7-[(4-fluorophenyl)methyl]-8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione (PubChem CID 3500292) has the molecular formula C21H19FN6O3 and a molecular weight of 422.42 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methyl]-8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione.
| Compound Name | 7-[(4-fluorophenyl)methyl]-8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3500292 |
| Molecular Formula | C21H19FN6O3 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 7-[(4-fluorophenyl)methyl]-8-[2-[1-(4-hydroxyphenyl)ethylidene]hydrazinyl]-3-methylpurine-2,6-dione |
| SMILES | CC(=NNc1nc2c(c(=O)[nH]c(=O)n2C)n1Cc1ccc(F)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H19FN6O3/c1-12(14-5-9-16(29)10-6-14)25-26-20-23-18-17(19(30)24-21(31)27(18)2)28(20)11-13-3-7-15(22)8-4-13/h3-10,29H,11H2,1-2H3,(H,23,26)(H,24,30,31) |
| InChIKey | CBYDETZBUGLWNN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|