C16H17N5O4 — CID 135795770
N-[(Z)-1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)propylideneamino]pyridine-4-carboxamide (PubChem CID 135795770) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[(Z)-1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)propylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)propylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135795770 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[(Z)-1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)propylideneamino]pyridine-4-carboxamide |
| SMILES | C=CCn1c(O)c(/C(CC)=N\NC(=O)c2ccncc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N5O4/c1-3-9-21-15(24)12(14(23)18-16(21)25)11(4-2)19-20-13(22)10-5-7-17-8-6-10/h3,5-8,24H,1,4,9H2,2H3,(H,20,22)(H,18,23,25)/b19-11- |
| InChIKey | YTLMAWVCZVLUTP-ODLFYWEKSA-N |
| XLogP | 0.37 |
| TPSA | 129.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|