C20H17ClN4O4 — CID 135398908
2-chloro-N-[(E)-1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]benzamide (PubChem CID 135398908) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is 2-chloro-N-[(E)-1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]benzamide.
| Compound Name | 2-chloro-N-[(E)-1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]benzamide |
|---|---|
| PubChem CID | 135398908 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 2-chloro-N-[(E)-1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]benzamide |
| SMILES | CC/C(=N\NC(=O)c1ccccc1Cl)c1c(O)n(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H17ClN4O4/c1-2-15(23-24-17(26)13-10-6-7-11-14(13)21)16-18(27)22-20(29)25(19(16)28)12-8-4-3-5-9-12/h3-11,28H,2H2,1H3,(H,24,26)(H,22,27,29)/b23-15+ |
| InChIKey | FRFBMPLXYMXYNE-HZHRSRAPSA-N |
| XLogP | 2.43 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|