C20H19N5O3S — CID 5141976
1-[1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]-3-phenylthiourea (PubChem CID 5141976) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 1-[1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]-3-phenylthiourea.
| Compound Name | 1-[1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 5141976 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1-[1-(6-hydroxy-2,4-dioxo-1-phenylpyrimidin-5-yl)propylideneamino]-3-phenylthiourea |
| SMILES | CCC(=NNC(=S)Nc1ccccc1)c1c(O)n(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H19N5O3S/c1-2-15(23-24-19(29)21-13-9-5-3-6-10-13)16-17(26)22-20(28)25(18(16)27)14-11-7-4-8-12-14/h3-12,27H,2H2,1H3,(H2,21,24,29)(H,22,26,28) |
| InChIKey | YPBPGJMSZTYKKA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|