C20H18ClN5O4 — CID 135822059
1-[(E)-1-[1-(4-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]propylideneamino]-3-phenylurea (PubChem CID 135822059) has the molecular formula C20H18ClN5O4 and a molecular weight of 427.85 g/mol. Its IUPAC name is 1-[(E)-1-[1-(4-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]propylideneamino]-3-phenylurea.
| Compound Name | 1-[(E)-1-[1-(4-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]propylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 135822059 |
| Molecular Formula | C20H18ClN5O4 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 1-[(E)-1-[1-(4-chlorophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]propylideneamino]-3-phenylurea |
| SMILES | CC/C(=N\NC(=O)Nc1ccccc1)c1c(O)n(-c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H18ClN5O4/c1-2-15(24-25-19(29)22-13-6-4-3-5-7-13)16-17(27)23-20(30)26(18(16)28)14-10-8-12(21)9-11-14/h3-11,28H,2H2,1H3,(H2,22,25,29)(H,23,27,30)/b24-15+ |
| InChIKey | CFOVLGQBWJUZOH-BUVRLJJBSA-N |
| XLogP | 2.82 |
| TPSA | 128.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|