C21H20ClN3O3 — CID 3812265
1-(4-chlorophenyl)-5-[C-ethyl-N-(2-phenylethyl)carbonimidoyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3812265) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[C-ethyl-N-(2-phenylethyl)carbonimidoyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-5-[C-ethyl-N-(2-phenylethyl)carbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3812265 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[C-ethyl-N-(2-phenylethyl)carbonimidoyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CC/C(=N\CCc1ccccc1)c1c(O)n(-c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H20ClN3O3/c1-2-17(23-13-12-14-6-4-3-5-7-14)18-19(26)24-21(28)25(20(18)27)16-10-8-15(22)9-11-16/h3-11,27H,2,12-13H2,1H3,(H,24,26,28)/b23-17+ |
| InChIKey | XXAQOTRMBDGXSF-HAVVHWLPSA-N |
| XLogP | 3.33 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|