C19H17ClN4O3 — CID 4977197
3-(4-chlorophenyl)-5-[C-ethyl-N-(pyridin-1-ium-3-ylmethyl)carbonimidoyl]-2,6-dioxopyrimidin-4-olate (PubChem CID 4977197) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[C-ethyl-N-(pyridin-1-ium-3-ylmethyl)carbonimidoyl]-2,6-dioxopyrimidin-4-olate.
| Compound Name | 3-(4-chlorophenyl)-5-[C-ethyl-N-(pyridin-1-ium-3-ylmethyl)carbonimidoyl]-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 4977197 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[C-ethyl-N-(pyridin-1-ium-3-ylmethyl)carbonimidoyl]-2,6-dioxopyrimidin-4-olate |
| SMILES | CC/C(=N\Cc1ccc[nH+]c1)c1c([O-])n(-c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H17ClN4O3/c1-2-15(22-11-12-4-3-9-21-10-12)16-17(25)23-19(27)24(18(16)26)14-7-5-13(20)6-8-14/h3-10,26H,2,11H2,1H3,(H,23,25,27)/b22-15+ |
| InChIKey | RGBPIASMJNJMRP-PXLXIMEGSA-N |
| XLogP | 1.47 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|