C16H13N5O5 — CID 137289257
N-[(Z)-[1-(furan-2-ylmethyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 137289257) has the molecular formula C16H13N5O5 and a molecular weight of 355.31 g/mol. Its IUPAC name is N-[(Z)-[1-(furan-2-ylmethyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[1-(furan-2-ylmethyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 137289257 |
| Molecular Formula | C16H13N5O5 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | N-[(Z)-[1-(furan-2-ylmethyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C\c1c(O)n(Cc2ccco2)c(=O)[nH]c1=O)c1ccncc1 |
| InChI | InChI=1S/C16H13N5O5/c22-13(10-3-5-17-6-4-10)20-18-8-12-14(23)19-16(25)21(15(12)24)9-11-2-1-7-26-11/h1-8,24H,9H2,(H,20,22)(H,19,23,25)/b18-8- |
| InChIKey | YDSSUAQSESKBRH-LSCVHKIXSA-N |
| XLogP | 0.04 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|