C15H17N3O5 — CID 135895118
1-(furan-2-ylmethyl)-6-hydroxy-5-[[(2R)-oxolan-2-yl]methyliminomethyl]pyrimidine-2,4-dione (PubChem CID 135895118) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-6-hydroxy-5-[[(2R)-oxolan-2-yl]methyliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(furan-2-ylmethyl)-6-hydroxy-5-[[(2R)-oxolan-2-yl]methyliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135895118 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-6-hydroxy-5-[[(2R)-oxolan-2-yl]methyliminomethyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccco2)c(O)c1/C=N/C[C@H]1CCCO1 |
| InChI | InChI=1S/C15H17N3O5/c19-13-12(8-16-7-10-3-1-5-22-10)14(20)18(15(21)17-13)9-11-4-2-6-23-11/h2,4,6,8,10,20H,1,3,5,7,9H2,(H,17,19,21)/b16-8+/t10-/m1/s1 |
| InChIKey | WBVXZFLUMIKXLC-LYQMGENXSA-N |
| XLogP | 0.48 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|