C14H17N3O5 — CID 4302922
1-(furan-2-ylmethyl)-6-hydroxy-5-(3-methoxypropyliminomethyl)pyrimidine-2,4-dione (PubChem CID 4302922) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-6-hydroxy-5-(3-methoxypropyliminomethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(furan-2-ylmethyl)-6-hydroxy-5-(3-methoxypropyliminomethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4302922 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(furan-2-ylmethyl)-6-hydroxy-5-(3-methoxypropyliminomethyl)pyrimidine-2,4-dione |
| SMILES | COCCC/N=C/c1c(O)n(Cc2ccco2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H17N3O5/c1-21-6-3-5-15-8-11-12(18)16-14(20)17(13(11)19)9-10-4-2-7-22-10/h2,4,7-8,19H,3,5-6,9H2,1H3,(H,16,18,20)/b15-8+ |
| InChIKey | GFLZODYRRFYHIB-OVCLIPMQSA-N |
| XLogP | 0.34 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|