C20H22N4O4 — CID 3741391
5-[[4-(diethylamino)phenyl]iminomethyl]-1-(furan-2-ylmethyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 3741391) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[[4-(diethylamino)phenyl]iminomethyl]-1-(furan-2-ylmethyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[[4-(diethylamino)phenyl]iminomethyl]-1-(furan-2-ylmethyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3741391 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 5-[[4-(diethylamino)phenyl]iminomethyl]-1-(furan-2-ylmethyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN(CC)c1ccc(/N=C/c2c(O)n(Cc3ccco3)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H22N4O4/c1-3-23(4-2)15-9-7-14(8-10-15)21-12-17-18(25)22-20(27)24(19(17)26)13-16-6-5-11-28-16/h5-12,26H,3-4,13H2,1-2H3,(H,22,25,27)/b21-12+ |
| InChIKey | BRDKUNXWGXDCLA-CIAFOILYSA-N |
| XLogP | 2.48 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|