C21H21N5O6 — CID 135429727
N-[(E)-[1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide (PubChem CID 135429727) has the molecular formula C21H21N5O6 and a molecular weight of 439.43 g/mol. Its IUPAC name is N-[(E)-[1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 135429727 |
| Molecular Formula | C21H21N5O6 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[(E)-[1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]pyridine-4-carboxamide |
| SMILES | COc1ccc(CCn2c(O)c(/C=N/NC(=O)c3ccncc3)c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C21H21N5O6/c1-31-16-4-3-13(11-17(16)32-2)7-10-26-20(29)15(19(28)24-21(26)30)12-23-25-18(27)14-5-8-22-9-6-14/h3-6,8-9,11-12,29H,7,10H2,1-2H3,(H,25,27)(H,24,28,30)/b23-12+ |
| InChIKey | UZYUTIXTRHURRP-FSJBWODESA-N |
| XLogP | 0.66 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|