C13H12FN5O4 — CID 135821968
[(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea (PubChem CID 135821968) has the molecular formula C13H12FN5O4 and a molecular weight of 321.27 g/mol. Its IUPAC name is [(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea.
| Compound Name | [(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea |
|---|---|
| PubChem CID | 135821968 |
| Molecular Formula | C13H12FN5O4 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | [(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]urea |
| SMILES | NC(=O)N/N=C/c1c(O)n(Cc2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H12FN5O4/c14-8-3-1-7(2-4-8)6-19-11(21)9(5-16-18-12(15)22)10(20)17-13(19)23/h1-5,21H,6H2,(H3,15,18,22)(H,17,20,23)/b16-5+ |
| InChIKey | MQOOBUBRUHBANY-FZSIALSZSA-N |
| XLogP | -0.57 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|