C22H17FN4O3 — CID 135420761
1-[(4-fluorophenyl)methyl]-6-hydroxy-5-[(E)-(naphthalen-1-ylhydrazinylidene)methyl]pyrimidine-2,4-dione (PubChem CID 135420761) has the molecular formula C22H17FN4O3 and a molecular weight of 404.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-6-hydroxy-5-[(E)-(naphthalen-1-ylhydrazinylidene)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-6-hydroxy-5-[(E)-(naphthalen-1-ylhydrazinylidene)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135420761 |
| Molecular Formula | C22H17FN4O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-6-hydroxy-5-[(E)-(naphthalen-1-ylhydrazinylidene)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(F)cc2)c(O)c1/C=N/Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H17FN4O3/c23-16-10-8-14(9-11-16)13-27-21(29)18(20(28)25-22(27)30)12-24-26-19-7-3-5-15-4-1-2-6-17(15)19/h1-12,26,29H,13H2,(H,25,28,30)/b24-12+ |
| InChIKey | LSDLOMXIEWZFBO-WYMPLXKRSA-N |
| XLogP | 3.03 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|