C18H21FN4O3 — CID 5041899
5-[(2-aminocyclohexyl)iminomethyl]-1-[(4-fluorophenyl)methyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 5041899) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is 5-[(2-aminocyclohexyl)iminomethyl]-1-[(4-fluorophenyl)methyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[(2-aminocyclohexyl)iminomethyl]-1-[(4-fluorophenyl)methyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5041899 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 5-[(2-aminocyclohexyl)iminomethyl]-1-[(4-fluorophenyl)methyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | NC1CCCCC1/N=C/c1c(O)n(Cc2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H21FN4O3/c19-12-7-5-11(6-8-12)10-23-17(25)13(16(24)22-18(23)26)9-21-15-4-2-1-3-14(15)20/h5-9,14-15,25H,1-4,10,20H2,(H,22,24,26)/b21-9+ |
| InChIKey | DMJRGYNXFLHVNK-ZVBGSRNCSA-N |
| XLogP | 1.12 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|