C18H23FN4O3 — CID 3318475
5-[3-(dimethylamino)propyliminomethyl]-1-[2-(4-fluorophenyl)ethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 3318475) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyliminomethyl]-1-[2-(4-fluorophenyl)ethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[3-(dimethylamino)propyliminomethyl]-1-[2-(4-fluorophenyl)ethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3318475 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 5-[3-(dimethylamino)propyliminomethyl]-1-[2-(4-fluorophenyl)ethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CN(C)CCC/N=C/c1c(O)n(CCc2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H23FN4O3/c1-22(2)10-3-9-20-12-15-16(24)21-18(26)23(17(15)25)11-8-13-4-6-14(19)7-5-13/h4-7,12,25H,3,8-11H2,1-2H3,(H,21,24,26)/b20-12+ |
| InChIKey | VGCNBQSALLZOBA-UDWIEESQSA-N |
| XLogP | 0.99 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|