C19H16FN5O3S — CID 135481406
1-[(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea (PubChem CID 135481406) has the molecular formula C19H16FN5O3S and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 135481406 |
| Molecular Formula | C19H16FN5O3S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-[(E)-[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-phenylthiourea |
| SMILES | O=c1[nH]c(=O)n(Cc2ccc(F)cc2)c(O)c1/C=N/NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H16FN5O3S/c20-13-8-6-12(7-9-13)11-25-17(27)15(16(26)23-19(25)28)10-21-24-18(29)22-14-4-2-1-3-5-14/h1-10,27H,11H2,(H2,22,24,29)(H,23,26,28)/b21-10+ |
| InChIKey | ATKHRXCGMNSNKV-UFFVCSGVSA-N |
| XLogP | 1.75 |
| TPSA | 111.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|