C23H19N3O3 — CID 137073461
6-hydroxy-5-(naphthalen-1-yliminomethyl)-1-(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 137073461) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 6-hydroxy-5-(naphthalen-1-yliminomethyl)-1-(2-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(naphthalen-1-yliminomethyl)-1-(2-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137073461 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 6-hydroxy-5-(naphthalen-1-yliminomethyl)-1-(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCc2ccccc2)c(O)c1/C=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C23H19N3O3/c27-21-19(15-24-20-12-6-10-17-9-4-5-11-18(17)20)22(28)26(23(29)25-21)14-13-16-7-2-1-3-8-16/h1-12,15,28H,13-14H2,(H,25,27,29)/b24-15+ |
| InChIKey | FFRCGJBAZCHVAZ-BUVRLJJBSA-N |
| XLogP | 3.39 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|