C19H15F2N3O3 — CID 137075421
5-[(2,4-difluorophenyl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 137075421) has the molecular formula C19H15F2N3O3 and a molecular weight of 371.34 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 5-[(2,4-difluorophenyl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137075421 |
| Molecular Formula | C19H15F2N3O3 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 5-[(2,4-difluorophenyl)iminomethyl]-6-hydroxy-1-(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCc2ccccc2)c(O)c1/C=N/c1ccc(F)cc1F |
| InChI | InChI=1S/C19H15F2N3O3/c20-13-6-7-16(15(21)10-13)22-11-14-17(25)23-19(27)24(18(14)26)9-8-12-4-2-1-3-5-12/h1-7,10-11,26H,8-9H2,(H,23,25,27)/b22-11+ |
| InChIKey | HYGVEDOXWMFKIV-SSDVNMTOSA-N |
| XLogP | 2.51 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|