C25H21BrN4O5S — CID 137070684
N-(2-bromophenyl)-4-[[6-hydroxy-2,4-dioxo-1-(2-phenylethyl)pyrimidin-5-yl]methylideneamino]benzenesulfonamide (PubChem CID 137070684) has the molecular formula C25H21BrN4O5S and a molecular weight of 569.44 g/mol. Its IUPAC name is N-(2-bromophenyl)-4-[[6-hydroxy-2,4-dioxo-1-(2-phenylethyl)pyrimidin-5-yl]methylideneamino]benzenesulfonamide.
| Compound Name | N-(2-bromophenyl)-4-[[6-hydroxy-2,4-dioxo-1-(2-phenylethyl)pyrimidin-5-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 137070684 |
| Molecular Formula | C25H21BrN4O5S |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 568.04 |
| IUPAC Name | N-(2-bromophenyl)-4-[[6-hydroxy-2,4-dioxo-1-(2-phenylethyl)pyrimidin-5-yl]methylideneamino]benzenesulfonamide |
| SMILES | O=c1[nH]c(=O)n(CCc2ccccc2)c(O)c1/C=N/c1ccc(S(=O)(=O)Nc2ccccc2Br)cc1 |
| InChI | InChI=1S/C25H21BrN4O5S/c26-21-8-4-5-9-22(21)29-36(34,35)19-12-10-18(11-13-19)27-16-20-23(31)28-25(33)30(24(20)32)15-14-17-6-2-1-3-7-17/h1-13,16,29,32H,14-15H2,(H,28,31,33)/b27-16+ |
| InChIKey | XYGNWFXTWLVLQW-JVWAILMASA-N |
| XLogP | 3.80 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|