C34H34N4O5S — CID 137070407
4-[[1-[4-(1-adamantyl)phenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-benzylbenzenesulfonamide (PubChem CID 137070407) has the molecular formula C34H34N4O5S and a molecular weight of 610.74 g/mol. Its IUPAC name is 4-[[1-[4-(1-adamantyl)phenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-benzylbenzenesulfonamide.
| Compound Name | 4-[[1-[4-(1-adamantyl)phenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-benzylbenzenesulfonamide |
|---|---|
| PubChem CID | 137070407 |
| Molecular Formula | C34H34N4O5S |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | 4-[[1-[4-(1-adamantyl)phenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-N-benzylbenzenesulfonamide |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)c(O)c1/C=N/c1ccc(S(=O)(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H34N4O5S/c39-31-30(21-35-27-8-12-29(13-9-27)44(42,43)36-20-22-4-2-1-3-5-22)32(40)38(33(41)37-31)28-10-6-26(7-11-28)34-17-23-14-24(18-34)16-25(15-23)19-34/h1-13,21,23-25,36,40H,14-20H2,(H,37,39,41)/b35-21+ |
| InChIKey | WQYIBGLLGDUIKL-XICOUIIWSA-N |
| XLogP | 4.93 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|