C28H29BrN4O5S — CID 137070474
4-[[1-[4-(1-adamantyl)-2-bromophenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide (PubChem CID 137070474) has the molecular formula C28H29BrN4O5S and a molecular weight of 613.53 g/mol. Its IUPAC name is 4-[[1-[4-(1-adamantyl)-2-bromophenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide.
| Compound Name | 4-[[1-[4-(1-adamantyl)-2-bromophenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 137070474 |
| Molecular Formula | C28H29BrN4O5S |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 4-[[1-[4-(1-adamantyl)-2-bromophenyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1/N=C/c1c(O)n(-c2ccc(C34CC5CC(CC(C5)C3)C4)cc2Br)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H29BrN4O5S/c1-15-6-20(39(30,37)38)3-4-23(15)31-14-21-25(34)32-27(36)33(26(21)35)24-5-2-19(10-22(24)29)28-11-16-7-17(12-28)9-18(8-16)13-28/h2-6,10,14,16-18,35H,7-9,11-13H2,1H3,(H2,30,37,38)(H,32,34,36)/b31-14+ |
| InChIKey | QNGIPDRFKAAVPZ-XAZZYMPDSA-N |
| XLogP | 4.17 |
| TPSA | 147.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|