C28H28BrN3O4 — CID 137070247
5-[[5-(1-adamantyl)-2-bromophenyl]iminomethyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione (PubChem CID 137070247) has the molecular formula C28H28BrN3O4 and a molecular weight of 550.45 g/mol. Its IUPAC name is 5-[[5-(1-adamantyl)-2-bromophenyl]iminomethyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione.
| Compound Name | 5-[[5-(1-adamantyl)-2-bromophenyl]iminomethyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 137070247 |
| Molecular Formula | C28H28BrN3O4 |
| Molecular Weight | 550.45 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 5-[[5-(1-adamantyl)-2-bromophenyl]iminomethyl]-6-hydroxy-1-(4-methoxyphenyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3cc(C45CC6CC(CC(C6)C4)C5)ccc3Br)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C28H28BrN3O4/c1-36-21-5-3-20(4-6-21)32-26(34)22(25(33)31-27(32)35)15-30-24-11-19(2-7-23(24)29)28-12-16-8-17(13-28)10-18(9-16)14-28/h2-7,11,15-18,34H,8-10,12-14H2,1H3,(H,31,33,35)/b30-15+ |
| InChIKey | GJSKOESXXUDPNS-FJEPWZHXSA-N |
| XLogP | 5.22 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|