C20H16N4O6 — CID 135777513
6-hydroxy-1-(4-methoxyphenyl)-5-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 135777513) has the molecular formula C20H16N4O6 and a molecular weight of 408.37 g/mol. Its IUPAC name is 6-hydroxy-1-(4-methoxyphenyl)-5-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1-(4-methoxyphenyl)-5-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135777513 |
| Molecular Formula | C20H16N4O6 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 6-hydroxy-1-(4-methoxyphenyl)-5-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(-n2c(O)c(/C=N/c3ccc4c(c3)oc(=O)n4C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H16N4O6/c1-23-15-8-3-11(9-16(15)30-20(23)28)21-10-14-17(25)22-19(27)24(18(14)26)12-4-6-13(29-2)7-5-12/h3-10,26H,1-2H3,(H,22,25,27)/b21-10+ |
| InChIKey | NCXXTPNMHQEQEQ-UFFVCSGVSA-N |
| XLogP | 1.44 |
| TPSA | 131.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|