C20H16ClN3O5 — CID 135628478
methyl 2-chloro-5-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate (PubChem CID 135628478) has the molecular formula C20H16ClN3O5 and a molecular weight of 413.82 g/mol. Its IUPAC name is methyl 2-chloro-5-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate.
| Compound Name | methyl 2-chloro-5-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 135628478 |
| Molecular Formula | C20H16ClN3O5 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | methyl 2-chloro-5-[[6-hydroxy-1-(4-methylphenyl)-2,4-dioxopyrimidin-5-yl]methylideneamino]benzoate |
| SMILES | COC(=O)c1cc(/N=C/c2c(O)n(-c3ccc(C)cc3)c(=O)[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C20H16ClN3O5/c1-11-3-6-13(7-4-11)24-18(26)15(17(25)23-20(24)28)10-22-12-5-8-16(21)14(9-12)19(27)29-2/h3-10,26H,1-2H3,(H,23,25,28)/b22-10+ |
| InChIKey | HNBGHTKQYDIEGN-LSHDLFTRSA-N |
| XLogP | 2.73 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|