C17H14ClN3O4 — CID 135619866
methyl 2-chloro-5-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzoate (PubChem CID 135619866) has the molecular formula C17H14ClN3O4 and a molecular weight of 359.77 g/mol. Its IUPAC name is methyl 2-chloro-5-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzoate.
| Compound Name | methyl 2-chloro-5-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 135619866 |
| Molecular Formula | C17H14ClN3O4 |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | methyl 2-chloro-5-[(5-cyano-2-hydroxy-1,4-dimethyl-6-oxo-3-pyridinyl)methylideneamino]benzoate |
| SMILES | COC(=O)c1cc(/N=C/c2c(C)c(C#N)c(=O)n(C)c2O)ccc1Cl |
| InChI | InChI=1S/C17H14ClN3O4/c1-9-12(7-19)15(22)21(2)16(23)13(9)8-20-10-4-5-14(18)11(6-10)17(24)25-3/h4-6,8,23H,1-3H3/b20-8+ |
| InChIKey | SXHLYURJZQCMOB-DNTJNYDQSA-N |
| XLogP | 2.46 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|