C17H15Cl2N3O2 — CID 135669081
5-[(3,4-dichlorophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile (PubChem CID 135669081) has the molecular formula C17H15Cl2N3O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile.
| Compound Name | 5-[(3,4-dichlorophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135669081 |
| Molecular Formula | C17H15Cl2N3O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(O)c(/C=N/c2ccc(Cl)c(Cl)c2)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C17H15Cl2N3O2/c1-3-6-22-16(23)12(8-20)10(2)13(17(22)24)9-21-11-4-5-14(18)15(19)7-11/h4-5,7,9,24H,3,6H2,1-2H3/b21-9+ |
| InChIKey | IAGUBLXBQFQCLB-ZVBGSRNCSA-N |
| XLogP | 4.20 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|